| A | This mineral is Anthropogenic. |
| G | This mineral is directly dated. |
| B | This mineral is reported as having this age. |
| Y | This mineral is using an age reported as an element mineralization period. |
| O | This mineral is using an age calculated from all data at the locality. |
| R | The age displayed for this mineral originates from a different, non-child locality. |
| P | The age displayed for this mineral is the range of ages for this mineral at all of this locality's children. |
| This mineral's age has not yet been recorded. |
| Mineral name | Structural Groups | IMA Formula | Max Age (Ma) | Min Age (Ma) | # of Sublocalities containing mineral | LOCALITY IDs, not mindat ids | # of localities containing mineral |
|---|---|---|---|---|---|---|---|
| Albite (*) | Feldspar | Na(AlSi3O8) | 2 | 50195,50196 | 8803 | ||
| Alluaudite (*) | Alluaudite | NaMnFe3+2(PO4)3 | 1 | 50195 | 94 | ||
| Analcime (*) | Analcime | Na(AlSi2O6)·H2O | 1 | 50195 | 1627 | ||
| Antimony (*) | Arsenic | Sb | 1820 | 1790 | 1 | 50198 | 363 |
| Arsenopyrite (*) | Arsenopyrite | FeAsS | 1820 | 1790 | 2 | 50197,50198 | 9052 |
| Aurostibite (*) | Pyrite | AuSb2 | 1820 | 1790 | 1 | 50198 | 73 |
| Bertrandite (*) | Not in a structural group | Be4Si2O7(OH)2 | 1 | 50194 | 606 | ||
| Beryl (*) | Beryl | Be3Al2Si6O18 | 3 | 50194,50195,50196 | 4286 | ||
| Bismuth (*) | Arsenic | Bi | 1820 | 1790 | 2 | 50197,50198 | 1966 |
| Breithauptite (*) | Nickeline | NiSb | 1820 | 1790 | 1 | 50198 | 175 |
| Cassiterite (*) | Rutile | SnO2 | 2 | 50195,50196 | 5171 | ||
| Chalcopyrite (*) | Chalcopyrite | CuFeS2 | 1820 | 1790 | 2 | 50197,50198 | 27198 |
| Clinosafflorite (*) | Löllingite | CoAs2 | 1820 | 1790 | 1 | 50198 | 21 |
| Cookeite (*) | Chlorite Clay | (Al,Li)3Al2(Si,Al)4O10(OH)8 | 1 | 50194 | 181 | ||
| Cordierite (*) | Beryl | Mg2Al4Si5O18 | 1 | 50199 | 1008 | ||
| Diopside (*) | Pyroxene | CaMgSi2O6 | 1 | 50199 | 4135 | ||
| Elbaite (*) | Tourmaline | Na(Al1.5Li1.5)Al6(Si6O18)(BO3)3(OH)3(OH) | 1 | 50195 | 520 | ||
| Fluorapatite (*) | Apatite | Ca5(PO4)3F | 1 | 50194 | 2740 | ||
| Galena (*) | Rocksalt | PbS | 1820 | 1790 | 3 | 50197,50198,50199 | 24243 |
| Geocronite (*) | Geocronite | Pb14Sb6S23 | 1820 | 1790 | 1 | 50198 | 133 |
| Gold (*) | Copper | Au | 1820 | 1790 | 2 | 50197,50198 | 30554 |
| Gudmundite (*) | Arsenopyrite | FeSbS | 1820 | 1790 | 1 | 50198 | 170 |
| Hedleyite (*) | Tetradymite | Bi7Te3 | 1820 | 1790 | 1 | 50197 | 104 |
| Hessite (*) | None | Ag2Te | 1820 | 1790 | 1 | 50197 | 804 |
| Hydroxylherderite (*) | Gadolinite | CaBe(PO4)(OH) | 1 | 50194 | 119 | ||
| Ilmenite (*) | Corundum | Fe2+Ti4+O3 | 1820 | 1790 | 2 | 50197,50198 | 5433 |
| Jordanite (*) | Geocronite | Pb14As6S23 | 1820 | 1790 | 1 | 50198 | 105 |
| Joséite-B (*) | Tetradymite | Bi4Te2S | 1820 | 1790 | 2 | 50197,50198 | 86 |
| Laumontite (*) | Not in a structural group | CaAl2Si4O12·4H2O | 1 | 50195 | 1271 | ||
| Löllingite (*) | Löllingite | FeAs2 | 1820 | 1790 | 1 | 50197 | 762 |
| Magnetite (*) | Spinel | Fe2+Fe3+2O4 | 1820 | 1790 | 2 | 50197,50198 | 14899 |
| Maldonite (*) | None | Au2Bi | 1820 | 1790 | 1 | 50198 | 88 |
| Microcline (*) | Feldspar | K(AlSi3O8) | 1 | 50195 | 4924 | ||
| Muscovite (*) | Mica Clay | KAl2(Si3Al)O10(OH)2 | 1 | 50195 | 17380 | ||
| Petalite (*) | Not in a structural group | LiAlSi4O10 | 1 | 50195 | 124 | ||
| Pollucite (*) | Analcime | Cs(Si2Al)O6·nH2O | 1 | 50195 | 140 | ||
| Pyrite (*) | Pyrite | FeS2 | 1820 | 1790 | 3 | 50197,50198,50199 | 39462 |
| Pyrrhotite (*) | Nickeline | Fe7S8 | 1820 | 1790 | 2 | 50197,50199 | 9056 |
| Quartz (*) | Quartz | SiO2 | 3 | 50195,50196,50199 | 61156 | ||
| Rubicline (*) | Feldspar | Rb(AlSi3O8) | 1 | 50195 | 6 | ||
| Rutile (*) | Rutile | TiO2 | 1820 | 1790 | 2 | 50196,50197 | 5614 |
| Safflorite (*) | Löllingite | CoAs2 | 1820 | 1790 | 1 | 50198 | 317 |
| Samarskite-(Y) (*) | Columbite | YFe3+Nb2O8 | 1 | 50196 | 353 | ||
| Scheelite (*) | Scheelite | Ca(WO4) | 1820 | 1790 | 2 | 50197,50198 | 4894 |
| Schorl (*) | Tourmaline | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) | 1 | 50195 | 2705 | ||
| Silver (*) | Copper | Ag | 1 | 50199 | 5186 | ||
| Sphalerite (*) | Sphalerite | ZnS | 1820 | 1790 | 2 | 50197,50199 | 21482 |
| Spodumene (*) | Pyroxene | LiAlSi2O6 | 2 | 50195,50196 | 688 | ||
| Tetrahedrite-(Zn) (*) | Tetrahedrite | Cu6(Cu4Zn2)Sb4S13 | 1 | 50199 | 5317 | ||
| Ullmannite (*) | Ullmannite | NiSbS | 1820 | 1790 | 1 | 50198 | 293 |
| Willyamite (*) | Cobaltite | CoSbS | 1820 | 1790 | 1 | 50198 | 25 |
| Excel ID | Max Age (Ma) | Min Age (Ma) | Age as listed in reference | Dating Method | Age Interpret | Prioritized? | Sample Source | Sample Num | Run Num | Age from other Locality | Dated Mineral | Minerals explicitely stated as having this age | Age applies to these Elements | MinDat Locality ID | Dated Locality (Max Age) | Location as listed in reference | Reference | Reference DOI | Reference ID | Age Notes | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Kristen002406 | 1820 | 1790 | gold mineralization | Au | 250922 | Satulinmäki Prospect, Somero, Southwest Finland, Finland | Riukka and Satulinmaki Gold Prospects | Saalmann et al. (2009) | 10.1016/j.precamres.2009.06.005 | PR174_53 |
| Sample | Source Locality | Reference URL |
|---|---|---|
All locality data graciously provided by mindat.org
All age data...
Other copyright data...